C24H45FO2Si — CID 174105753
(1R,3aR,7aR)-1-(5-fluoro-6-methyl-6-triethylsilyloxyheptan-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 174105753) has the molecular formula C24H45FO2Si and a molecular weight of 412.71 g/mol. Its IUPAC name is (1R,3aR,7aR)-1-(5-fluoro-6-methyl-6-triethylsilyloxyheptan-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (1R,3aR,7aR)-1-(5-fluoro-6-methyl-6-triethylsilyloxyheptan-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 174105753 |
| Molecular Formula | C24H45FO2Si |
| Molecular Weight | 412.71 g/mol |
| Exact Mass | 412.32 |
| IUPAC Name | (1R,3aR,7aR)-1-(5-fluoro-6-methyl-6-triethylsilyloxyheptan-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | CC[Si](CC)(CC)OC(C)(C)C(F)CCC(C)[C@H]1CC[C@H]2C(=O)CCC[C@]12C |
| InChI | InChI=1S/C24H45FO2Si/c1-8-28(9-2,10-3)27-23(5,6)22(25)16-13-18(4)19-14-15-20-21(26)12-11-17-24(19,20)7/h18-20,22H,8-17H2,1-7H3/t18?,19-,20+,22?,24-/m1/s1 |
| InChIKey | PQURPAKERSFYEK-GMBQABAHSA-N |
| XLogP | 7.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.71 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|