C26H49FO2Si — CID 174105764
2-[(1R,3aS,7aR)-1-[(2R,5R)-5-fluoro-6-methyl-6-triethylsilyloxyheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethanol (PubChem CID 174105764) has the molecular formula C26H49FO2Si and a molecular weight of 440.76 g/mol. Its IUPAC name is 2-[(1R,3aS,7aR)-1-[(2R,5R)-5-fluoro-6-methyl-6-triethylsilyloxyheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethanol.
| Compound Name | 2-[(1R,3aS,7aR)-1-[(2R,5R)-5-fluoro-6-methyl-6-triethylsilyloxyheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethanol |
|---|---|
| PubChem CID | 174105764 |
| Molecular Formula | C26H49FO2Si |
| Molecular Weight | 440.76 g/mol |
| Exact Mass | 440.35 |
| IUPAC Name | 2-[(1R,3aS,7aR)-1-[(2R,5R)-5-fluoro-6-methyl-6-triethylsilyloxyheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethanol |
| SMILES | CC[Si](CC)(CC)OC(C)(C)[C@H](F)CC[C@@H](C)[C@H]1CC[C@H]2C(=CCO)CCC[C@]12C |
| InChI | InChI=1S/C26H49FO2Si/c1-8-30(9-2,10-3)29-25(5,6)24(27)16-13-20(4)22-14-15-23-21(17-19-28)12-11-18-26(22,23)7/h17,20,22-24,28H,8-16,18-19H2,1-7H3/t20-,22-,23+,24-,26-/m1/s1 |
| InChIKey | YORZUMVBNWLLLY-DNMDETFRSA-N |
| XLogP | 7.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.76 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|