C22H39B2NO6S — CID 174107616
tert-butyl-[[(1S)-1-(furan-2-yl)-2,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]amino]-oxidosulfanium (PubChem CID 174107616) has the molecular formula C22H39B2NO6S and a molecular weight of 467.25 g/mol. Its IUPAC name is tert-butyl-[[(1S)-1-(furan-2-yl)-2,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(1S)-1-(furan-2-yl)-2,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 174107616 |
| Molecular Formula | C22H39B2NO6S |
| Molecular Weight | 467.25 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | tert-butyl-[[(1S)-1-(furan-2-yl)-2,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]amino]-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])N[C@H](c1ccco1)C(B1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H39B2NO6S/c1-18(2,3)32(26)25-16(15-13-12-14-27-15)17(23-28-19(4,5)20(6,7)29-23)24-30-21(8,9)22(10,11)31-24/h12-14,16-17,25H,1-11H3/t16-,32?/m1/s1 |
| InChIKey | XFRWGSOAMPMLNP-FCBBPLNGSA-N |
| XLogP | 4.47 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.25 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|