C28H56N6 — CID 174108491
(3E,5Z,7E)-9-[3-[2-(6-aminohexan-2-ylamino)ethyl-methylamino]butylimino]-5-ethylidene-3-methyl-2-N-propylnona-3,7-diene-2,6-diamine (PubChem CID 174108491) has the molecular formula C28H56N6 and a molecular weight of 476.80 g/mol. Its IUPAC name is (3E,5Z,7E)-9-[3-[2-(6-aminohexan-2-ylamino)ethyl-methylamino]butylimino]-5-ethylidene-3-methyl-2-N-propylnona-3,7-diene-2,6-diamine.
| Compound Name | (3E,5Z,7E)-9-[3-[2-(6-aminohexan-2-ylamino)ethyl-methylamino]butylimino]-5-ethylidene-3-methyl-2-N-propylnona-3,7-diene-2,6-diamine |
|---|---|
| PubChem CID | 174108491 |
| Molecular Formula | C28H56N6 |
| Molecular Weight | 476.80 g/mol |
| Exact Mass | 476.46 |
| IUPAC Name | (3E,5Z,7E)-9-[3-[2-(6-aminohexan-2-ylamino)ethyl-methylamino]butylimino]-5-ethylidene-3-methyl-2-N-propylnona-3,7-diene-2,6-diamine |
| SMILES | C/C=C(/C=C(\C)C(C)NCCC)C(N)/C=C/C=N/CCC(C)N(C)CCNC(C)CCCCN |
| InChI | InChI=1S/C28H56N6/c1-8-17-33-26(6)23(3)22-27(9-2)28(30)14-12-18-31-19-15-25(5)34(7)21-20-32-24(4)13-10-11-16-29/h9,12,14,18,22,24-26,28,32-33H,8,10-11,13,15-17,19-21,29-30H2,1-7H3/b14-12+,23-22+,27-9-,31-18+ |
| InChIKey | LOSATKLURBKPME-NZWOOKCOSA-N |
| XLogP | 4.04 |
| TPSA | 91.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.80 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|