C22H27NS2 — CID 174109603
5-[(2Z,4E,6Z)-5,6-dimethyl-7-(3-methylidene-4H-thiopyran-4-yl)-2-methylsulfanylhepta-2,4,6-trien-3-yl]-4-methylidene-3H-pyridine (PubChem CID 174109603) has the molecular formula C22H27NS2 and a molecular weight of 369.60 g/mol. Its IUPAC name is 5-[(2Z,4E,6Z)-5,6-dimethyl-7-(3-methylidene-4H-thiopyran-4-yl)-2-methylsulfanylhepta-2,4,6-trien-3-yl]-4-methylidene-3H-pyridine.
| Compound Name | 5-[(2Z,4E,6Z)-5,6-dimethyl-7-(3-methylidene-4H-thiopyran-4-yl)-2-methylsulfanylhepta-2,4,6-trien-3-yl]-4-methylidene-3H-pyridine |
|---|---|
| PubChem CID | 174109603 |
| Molecular Formula | C22H27NS2 |
| Molecular Weight | 369.60 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 5-[(2Z,4E,6Z)-5,6-dimethyl-7-(3-methylidene-4H-thiopyran-4-yl)-2-methylsulfanylhepta-2,4,6-trien-3-yl]-4-methylidene-3H-pyridine |
| SMILES | C=C1CC=NC=C1C(/C=C(C)/C(C)=C\C1C=CSCC1=C)=C(/C)SC |
| InChI | InChI=1S/C22H27NS2/c1-15-7-9-23-13-22(15)21(19(5)24-6)12-17(3)16(2)11-20-8-10-25-14-18(20)4/h8-13,20H,1,4,7,14H2,2-3,5-6H3/b16-11-,17-12+,21-19- |
| InChIKey | UBTCOKNXGCBNML-ZPIHBRMISA-N |
| XLogP | 6.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.60 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|