C21H38N6O6Si — CID 174110451
methyl (2S,4S,5R)-2,3-diazido-6-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4,5-dimethyloxane-2-carboxylate (PubChem CID 174110451) has the molecular formula C21H38N6O6Si and a molecular weight of 498.66 g/mol. Its IUPAC name is methyl (2S,4S,5R)-2,3-diazido-6-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4,5-dimethyloxane-2-carboxylate.
| Compound Name | methyl (2S,4S,5R)-2,3-diazido-6-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4,5-dimethyloxane-2-carboxylate |
|---|---|
| PubChem CID | 174110451 |
| Molecular Formula | C21H38N6O6Si |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | methyl (2S,4S,5R)-2,3-diazido-6-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4,5-dimethyloxane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(N=[N+]=[N-])OC([C@H](O[Si](C)(C)C(C)(C)C)[C@H]2COC(C)(C)O2)[C@H](C)[C@H](C)C1N=[N+]=[N-] |
| InChI | InChI=1S/C21H38N6O6Si/c1-12-13(2)17(24-26-22)21(25-27-23,18(28)29-8)32-15(12)16(14-11-30-20(6,7)31-14)33-34(9,10)19(3,4)5/h12-17H,11H2,1-10H3/t12-,13+,14-,15?,16-,17?,21+/m1/s1 |
| InChIKey | ZQDMAPIWDCJYGO-GRXSCGOXSA-N |
| XLogP | 5.06 |
| TPSA | 160.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|