C17H22N6O11 — CID 174110482
methyl (2S,5R)-4,5-diacetyloxy-2,3-diazido-6-[(1R)-1,2-diacetyloxyethyl]oxane-2-carboxylate (PubChem CID 174110482) has the molecular formula C17H22N6O11 and a molecular weight of 486.39 g/mol. Its IUPAC name is methyl (2S,5R)-4,5-diacetyloxy-2,3-diazido-6-[(1R)-1,2-diacetyloxyethyl]oxane-2-carboxylate.
| Compound Name | methyl (2S,5R)-4,5-diacetyloxy-2,3-diazido-6-[(1R)-1,2-diacetyloxyethyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 174110482 |
| Molecular Formula | C17H22N6O11 |
| Molecular Weight | 486.39 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | methyl (2S,5R)-4,5-diacetyloxy-2,3-diazido-6-[(1R)-1,2-diacetyloxyethyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(N=[N+]=[N-])OC([C@@H](COC(C)=O)OC(C)=O)[C@H](OC(C)=O)C(OC(C)=O)C1N=[N+]=[N-] |
| InChI | InChI=1S/C17H22N6O11/c1-7(24)30-6-11(31-8(2)25)12-13(32-9(3)26)14(33-10(4)27)15(20-22-18)17(34-12,21-23-19)16(28)29-5/h11-15H,6H2,1-5H3/t11-,12?,13+,14?,15?,17+/m1/s1 |
| InChIKey | OJKYWIDKHAMIMV-HMFMRYHPSA-N |
| XLogP | 0.60 |
| TPSA | 238.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.39 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|