C43H39N2OSi+ — CID 174110653
[1',3-bis(ethenyl)-14-methyl-7'-phenylspiro[1-azoniatetracyclo[10.4.0.02,5.06,11]hexadeca-1(12),6,8,10,13,15-hexaene-4,3'-4H-[1]benzofuro[3,2-h]isoquinoline]-15-yl]-trimethylsilane (PubChem CID 174110653) has the molecular formula C43H39N2OSi+ and a molecular weight of 627.88 g/mol. Its IUPAC name is [1',3-bis(ethenyl)-14-methyl-7'-phenylspiro[1-azoniatetracyclo[10.4.0.02,5.06,11]hexadeca-1(12),6,8,10,13,15-hexaene-4,3'-4H-[1]benzofuro[3,2-h]isoquinoline]-15-yl]-trimethylsilane.
| Compound Name | [1',3-bis(ethenyl)-14-methyl-7'-phenylspiro[1-azoniatetracyclo[10.4.0.02,5.06,11]hexadeca-1(12),6,8,10,13,15-hexaene-4,3'-4H-[1]benzofuro[3,2-h]isoquinoline]-15-yl]-trimethylsilane |
|---|---|
| PubChem CID | 174110653 |
| Molecular Formula | C43H39N2OSi+ |
| Molecular Weight | 627.88 g/mol |
| Exact Mass | 627.28 |
| IUPAC Name | [1',3-bis(ethenyl)-14-methyl-7'-phenylspiro[1-azoniatetracyclo[10.4.0.02,5.06,11]hexadeca-1(12),6,8,10,13,15-hexaene-4,3'-4H-[1]benzofuro[3,2-h]isoquinoline]-15-yl]-trimethylsilane |
| SMILES | C=CC1=NC2(Cc3ccc4c(oc5cccc(-c6ccccc6)c54)c31)C(C=C)C1C2c2ccccc2-c2cc(C)c([Si](C)(C)C)c[n+]21 |
| InChI | InChI=1S/C43H39N2OSi/c1-7-33-41-40(31-18-13-12-17-30(31)35-23-26(3)37(25-45(35)41)47(4,5)6)43(33)24-28-21-22-32-39-29(27-15-10-9-11-16-27)19-14-20-36(39)46-42(32)38(28)34(8-2)44-43/h7-23,25,33,40-41H,1-2,24H2,3-6H3/q+1 |
| InChIKey | HIXXBGOUOUYDMR-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 29.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.88 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|