C36H29BO4 — CID 174110681
2-[9-(2-dibenzofuran-3-ylphenyl)dibenzofuran-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 174110681) has the molecular formula C36H29BO4 and a molecular weight of 536.44 g/mol. Its IUPAC name is 2-[9-(2-dibenzofuran-3-ylphenyl)dibenzofuran-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[9-(2-dibenzofuran-3-ylphenyl)dibenzofuran-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 174110681 |
| Molecular Formula | C36H29BO4 |
| Molecular Weight | 536.44 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | 2-[9-(2-dibenzofuran-3-ylphenyl)dibenzofuran-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc3c(c2)oc2cccc(-c4ccccc4-c4ccc5c(c4)oc4ccccc45)c23)OC1(C)C |
| InChI | InChI=1S/C36H29BO4/c1-35(2)36(3,4)41-37(40-35)23-17-19-29-33(21-23)39-31-15-9-13-28(34(29)31)25-11-6-5-10-24(25)22-16-18-27-26-12-7-8-14-30(26)38-32(27)20-22/h5-21H,1-4H3 |
| InChIKey | PDEHGKMJJXYSKO-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 44.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.44 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|