C16H17N3O2S — CID 17411074
4-(2-morpholin-4-ylethylsulfanyl)-[1]benzofuro[3,2-d]pyrimidine (PubChem CID 17411074) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is 4-(2-morpholin-4-ylethylsulfanyl)-[1]benzofuro[3,2-d]pyrimidine.
| Compound Name | 4-(2-morpholin-4-ylethylsulfanyl)-[1]benzofuro[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 17411074 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 4-(2-morpholin-4-ylethylsulfanyl)-[1]benzofuro[3,2-d]pyrimidine |
| SMILES | c1ccc2c(c1)oc1c(SCCN3CCOCC3)ncnc12 |
| InChI | InChI=1S/C16H17N3O2S/c1-2-4-13-12(3-1)14-15(21-13)16(18-11-17-14)22-10-7-19-5-8-20-9-6-19/h1-4,11H,5-10H2 |
| InChIKey | NTBFZJCWZZFHPI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |