C27H25BFN3O7S — CID 174110937
benzyl [3-[5-(1,3,2-dioxaborinan-2-yl)-4-methyl-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]-2-fluoro-4-methylphenyl]sulfamoylformate (PubChem CID 174110937) has the molecular formula C27H25BFN3O7S and a molecular weight of 565.39 g/mol. Its IUPAC name is benzyl [3-[5-(1,3,2-dioxaborinan-2-yl)-4-methyl-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]-2-fluoro-4-methylphenyl]sulfamoylformate.
| Compound Name | benzyl [3-[5-(1,3,2-dioxaborinan-2-yl)-4-methyl-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]-2-fluoro-4-methylphenyl]sulfamoylformate |
|---|---|
| PubChem CID | 174110937 |
| Molecular Formula | C27H25BFN3O7S |
| Molecular Weight | 565.39 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | benzyl [3-[5-(1,3,2-dioxaborinan-2-yl)-4-methyl-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]-2-fluoro-4-methylphenyl]sulfamoylformate |
| SMILES | Cc1ccc(NS(=O)(=O)C(=O)OCc2ccccc2)c(F)c1C(=O)c1c[nH]c2ncc(B3OCCCO3)c(C)c12 |
| InChI | InChI=1S/C27H25BFN3O7S/c1-16-9-10-21(32-40(35,36)27(34)37-15-18-7-4-3-5-8-18)24(29)22(16)25(33)19-13-30-26-23(19)17(2)20(14-31-26)28-38-11-6-12-39-28/h3-5,7-10,13-14,32H,6,11-12,15H2,1-2H3,(H,30,31) |
| InChIKey | PLWPUZSJZDHJAD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|