C54H42B10N2 — CID 174110940
CID 174110940 (PubChem CID 174110940) has the molecular formula C54H42B10N2 and a molecular weight of 827.06 g/mol.
| Compound Name | CID 174110940 |
|---|---|
| PubChem CID | 174110940 |
| Molecular Formula | C54H42B10N2 |
| Molecular Weight | 827.06 g/mol |
| Exact Mass | 828.43 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2cc(-c3c([B])c([B])c([B])c([B])c3[B])cc(-n3c4ccccc4c4ccc(-n5c6ccc(C(C)(C)C)cc6c6cc(C(C)(C)C)ccc65)c(C(C)(C)C)c43)c2)c([B])c1[B] |
| InChI | InChI=1S/C54H42B10N2/c1-52(2,3)27-14-17-35-32(23-27)33-24-28(53(4,5)6)15-18-36(33)66(35)37-19-16-31-30-12-10-11-13-34(30)65(51(31)40(37)54(7,8)9)29-21-25(38-41(55)45(59)49(63)46(60)42(38)56)20-26(22-29)39-43(57)47(61)50(64)48(62)44(39)58/h10-24H,1-9H3 |
| InChIKey | RMUXZPKCUQCQNE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 66 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.06 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|