C21H23N7O3S — CID 174111618
4-[2-[[6-(methoxymethyl)-2-pyridinyl]methylimino]ethanehydrazonoyl]-6-(3-methylsulfonylphenyl)pyrimidin-2-amine (PubChem CID 174111618) has the molecular formula C21H23N7O3S and a molecular weight of 453.53 g/mol. Its IUPAC name is 4-[2-[[6-(methoxymethyl)-2-pyridinyl]methylimino]ethanehydrazonoyl]-6-(3-methylsulfonylphenyl)pyrimidin-2-amine.
| Compound Name | 4-[2-[[6-(methoxymethyl)-2-pyridinyl]methylimino]ethanehydrazonoyl]-6-(3-methylsulfonylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 174111618 |
| Molecular Formula | C21H23N7O3S |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 4-[2-[[6-(methoxymethyl)-2-pyridinyl]methylimino]ethanehydrazonoyl]-6-(3-methylsulfonylphenyl)pyrimidin-2-amine |
| SMILES | COCc1cccc(C/N=C/C(=NN)c2cc(-c3cccc(S(C)(=O)=O)c3)nc(N)n2)n1 |
| InChI | InChI=1S/C21H23N7O3S/c1-31-13-16-7-4-6-15(25-16)11-24-12-20(28-23)19-10-18(26-21(22)27-19)14-5-3-8-17(9-14)32(2,29)30/h3-10,12H,11,13,23H2,1-2H3,(H2,22,26,27)/b24-12+,28-20? |
| InChIKey | UQRYMTQNKOBORL-AHMHFDSUSA-N |
| XLogP | 1.60 |
| TPSA | 158.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|