About (1Z,5Z)-7-(chloromethyl)-2-fluorobicyclo[4.3.3]dodeca-1,5-diene
(1Z,5Z)-7-(chloromethyl)-2-fluorobicyclo[4.3.3]dodeca-1,5-diene (PubChem CID 174112004) has the molecular formula C13H18ClF
and a molecular weight of 228.74 g/mol. Its IUPAC name is (1Z,5Z)-7-(chloromethyl)-2-fluorobicyclo[4.3.3]dodeca-1,5-diene.
Molecular Properties
| Compound Name | (1Z,5Z)-7-(chloromethyl)-2-fluorobicyclo[4.3.3]dodeca-1,5-diene |
| PubChem CID | 174112004 |
| Molecular Formula | C13H18ClF |
| Molecular Weight | 228.74 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | (1Z,5Z)-7-(chloromethyl)-2-fluorobicyclo[4.3.3]dodeca-1,5-diene |
| SMILES | F/C1=C2\CCC/C(=C/CC1)C(CCl)CC2 |
| InChI | InChI=1S/C13H18ClF/c14-9-12-8-7-11-5-1-3-10(12)4-2-6-13(11)15/h4,12H,1-3,5-9H2/b10-4+,13-11- |
| InChIKey | MSBTUWWXPYEGMU-NSFUCJGNSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.74 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1Z,5Z)-7-(chloromethyl)-2-fluorobicyclo[4.3.3]dodeca-1,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,5Z)-7-(chloromethyl)-2-fluorobicyclo[4.3.3]dodeca-1,5-diene?
The IUPAC name of (1Z,5Z)-7-(chloromethyl)-2-fluorobicyclo[4.3.3]dodeca-1,5-diene (CID 174112004) is (1Z,5Z)-7-(chloromethyl)-2-fluorobicyclo[4.3.3]dodeca-1,5-diene.
What is the SMILES notation for (1Z,5Z)-7-(chloromethyl)-2-fluorobicyclo[4.3.3]dodeca-1,5-diene?
The canonical SMILES for (1Z,5Z)-7-(chloromethyl)-2-fluorobicyclo[4.3.3]dodeca-1,5-diene is F/C1=C2\CCC/C(=C/CC1)C(CCl)CC2.
What is the InChIKey of (1Z,5Z)-7-(chloromethyl)-2-fluorobicyclo[4.3.3]dodeca-1,5-diene?
The InChIKey is MSBTUWWXPYEGMU-NSFUCJGNSA-N. The full InChI is InChI=1S/C13H18ClF/c14-9-12-8-7-11-5-1-3-10(12)4-2-6-13(11)15/h4,12H,1-3,5-9H2/b10-4+,13-11-.
What are the key properties of (1Z,5Z)-7-(chloromethyl)-2-fluorobicyclo[4.3.3]dodeca-1,5-diene?
(1Z,5Z)-7-(chloromethyl)-2-fluorobicyclo[4.3.3]dodeca-1,5-diene has a molecular weight of 228.74 g/mol, XLogP of 4.75, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,5Z)-7-(chloromethyl)-2-fluorobicyclo[4.3.3]dodeca-1,5-diene is sourced from PubChem (CID 174112004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).