C17H21F3N2O2 — CID 17411208
N-(4-acetylphenyl)-2-[3-(trifluoromethyl)piperidin-1-yl]propanamide (PubChem CID 17411208) has the molecular formula C17H21F3N2O2 and a molecular weight of 342.36 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-[3-(trifluoromethyl)piperidin-1-yl]propanamide.
| Compound Name | N-(4-acetylphenyl)-2-[3-(trifluoromethyl)piperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 17411208 |
| Molecular Formula | C17H21F3N2O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N-(4-acetylphenyl)-2-[3-(trifluoromethyl)piperidin-1-yl]propanamide |
| SMILES | CC(=O)c1ccc(NC(=O)C(C)N2CCCC(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C17H21F3N2O2/c1-11(22-9-3-4-14(10-22)17(18,19)20)16(24)21-15-7-5-13(6-8-15)12(2)23/h5-8,11,14H,3-4,9-10H2,1-2H3,(H,21,24) |
| InChIKey | CUOTUFICBAXYOD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |