C13H22N2 — CID 174112122
4,10,11-trimethyl-6,8,9,10,11,11a-hexahydro-1H-pyrido[1,2-a][1,3]diazocine (PubChem CID 174112122) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 4,10,11-trimethyl-6,8,9,10,11,11a-hexahydro-1H-pyrido[1,2-a][1,3]diazocine.
| Compound Name | 4,10,11-trimethyl-6,8,9,10,11,11a-hexahydro-1H-pyrido[1,2-a][1,3]diazocine |
|---|---|
| PubChem CID | 174112122 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 4,10,11-trimethyl-6,8,9,10,11,11a-hexahydro-1H-pyrido[1,2-a][1,3]diazocine |
| SMILES | CC1=CCN2CCC(C)C(C)C2NC=C1 |
| InChI | InChI=1S/C13H22N2/c1-10-4-7-14-13-12(3)11(2)6-9-15(13)8-5-10/h4-5,7,11-14H,6,8-9H2,1-3H3 |
| InChIKey | TXMFOSJHXJCRMK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |