C49H22B7N3OS — CID 174112667
CID 174112667 (PubChem CID 174112667) has the molecular formula C49H22B7N3OS and a molecular weight of 776.49 g/mol.
| Compound Name | CID 174112667 |
|---|---|
| PubChem CID | 174112667 |
| Molecular Formula | C49H22B7N3OS |
| Molecular Weight | 776.49 g/mol |
| Exact Mass | 777.21 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c2c(sc3c([B])c([B])c([B])c(-c4nc(-c5cccc(-c6ccc(-c7ccc8ccccc8c7)cc6)c5)nc(-c5cccc6oc7ccccc7c56)n4)c32)c1[B] |
| InChI | InChI=1S/C49H22B7N3OS/c50-38-36-35-37(39(51)41(53)43(55)45(35)61-46(36)44(56)42(54)40(38)52)49-58-47(57-48(59-49)31-12-6-14-33-34(31)30-11-3-4-13-32(30)60-33)29-10-5-9-27(22-29)24-15-17-25(18-16-24)28-20-19-23-7-1-2-8-26(23)21-28/h1-22H |
| InChIKey | DRHVYPNEUSGXJC-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|