C17H20BF3N2O3 — CID 174113191
4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyrazol-1-yl]methyl]phenol (PubChem CID 174113191) has the molecular formula C17H20BF3N2O3 and a molecular weight of 368.16 g/mol. Its IUPAC name is 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyrazol-1-yl]methyl]phenol.
| Compound Name | 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyrazol-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 174113191 |
| Molecular Formula | C17H20BF3N2O3 |
| Molecular Weight | 368.16 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyrazol-1-yl]methyl]phenol |
| SMILES | CC1(C)OB(c2cn(Cc3ccc(O)cc3)nc2C(F)(F)F)OC1(C)C |
| InChI | InChI=1S/C17H20BF3N2O3/c1-15(2)16(3,4)26-18(25-15)13-10-23(22-14(13)17(19,20)21)9-11-5-7-12(24)8-6-11/h5-8,10,24H,9H2,1-4H3 |
| InChIKey | FIOHLMUSXNEZJG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.16 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|