C18H34N2 — CID 174113941
(6E,8S)-6-ethylidene-4,8-dimethyl-2-methylimino-4-prop-1-en-2-yldecan-1-amine (PubChem CID 174113941) has the molecular formula C18H34N2 and a molecular weight of 278.48 g/mol. Its IUPAC name is (6E,8S)-6-ethylidene-4,8-dimethyl-2-methylimino-4-prop-1-en-2-yldecan-1-amine.
| Compound Name | (6E,8S)-6-ethylidene-4,8-dimethyl-2-methylimino-4-prop-1-en-2-yldecan-1-amine |
|---|---|
| PubChem CID | 174113941 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | (6E,8S)-6-ethylidene-4,8-dimethyl-2-methylimino-4-prop-1-en-2-yldecan-1-amine |
| SMILES | C=C(C)C(C)(C/C(CN)=N/C)C/C(=C/C)C[C@@H](C)CC |
| InChI | InChI=1S/C18H34N2/c1-8-15(5)10-16(9-2)11-18(6,14(3)4)12-17(13-19)20-7/h9,15H,3,8,10-13,19H2,1-2,4-7H3/b16-9+,20-17-/t15-,18?/m0/s1 |
| InChIKey | GGNTWTVFMZCAKZ-MIXLCVGLSA-N |
| XLogP | 4.76 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|