C19H27F3N4O2S2 — CID 174114332
N'-(1-methylsulfonylpiperidin-4-yl)-N-[(1E,3Z)-4-methyl-1-(1,3-thiazol-5-yl)-2-(trifluoromethyl)hexa-1,3-dienyl]ethanimidamide (PubChem CID 174114332) has the molecular formula C19H27F3N4O2S2 and a molecular weight of 464.58 g/mol. Its IUPAC name is N'-(1-methylsulfonylpiperidin-4-yl)-N-[(1E,3Z)-4-methyl-1-(1,3-thiazol-5-yl)-2-(trifluoromethyl)hexa-1,3-dienyl]ethanimidamide.
| Compound Name | N'-(1-methylsulfonylpiperidin-4-yl)-N-[(1E,3Z)-4-methyl-1-(1,3-thiazol-5-yl)-2-(trifluoromethyl)hexa-1,3-dienyl]ethanimidamide |
|---|---|
| PubChem CID | 174114332 |
| Molecular Formula | C19H27F3N4O2S2 |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | N'-(1-methylsulfonylpiperidin-4-yl)-N-[(1E,3Z)-4-methyl-1-(1,3-thiazol-5-yl)-2-(trifluoromethyl)hexa-1,3-dienyl]ethanimidamide |
| SMILES | CC/C(C)=C\C(=C(/N/C(C)=N/C1CCN(S(C)(=O)=O)CC1)c1cncs1)C(F)(F)F |
| InChI | InChI=1S/C19H27F3N4O2S2/c1-5-13(2)10-16(19(20,21)22)18(17-11-23-12-29-17)25-14(3)24-15-6-8-26(9-7-15)30(4,27)28/h10-12,15H,5-9H2,1-4H3,(H,24,25)/b13-10-,18-16+ |
| InChIKey | WVXBMHWAXQKJFP-GCRZPWQESA-N |
| XLogP | 4.20 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|