C27H31Cl2N3O4 — CID 174114527
[5-[4-[3-[4-[(2E,5Z)-6,7-dichloroocta-2,5,7-trien-3-yl]piperidin-1-yl]propoxy]-1-benzofuran-2-yl]-1,3,4-oxadiazol-2-yl]methanol (PubChem CID 174114527) has the molecular formula C27H31Cl2N3O4 and a molecular weight of 532.47 g/mol. Its IUPAC name is [5-[4-[3-[4-[(2E,5Z)-6,7-dichloroocta-2,5,7-trien-3-yl]piperidin-1-yl]propoxy]-1-benzofuran-2-yl]-1,3,4-oxadiazol-2-yl]methanol.
| Compound Name | [5-[4-[3-[4-[(2E,5Z)-6,7-dichloroocta-2,5,7-trien-3-yl]piperidin-1-yl]propoxy]-1-benzofuran-2-yl]-1,3,4-oxadiazol-2-yl]methanol |
|---|---|
| PubChem CID | 174114527 |
| Molecular Formula | C27H31Cl2N3O4 |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | [5-[4-[3-[4-[(2E,5Z)-6,7-dichloroocta-2,5,7-trien-3-yl]piperidin-1-yl]propoxy]-1-benzofuran-2-yl]-1,3,4-oxadiazol-2-yl]methanol |
| SMILES | C=C(Cl)/C(Cl)=C/C/C(=C\C)C1CCN(CCCOc2cccc3oc(-c4nnc(CO)o4)cc23)CC1 |
| InChI | InChI=1S/C27H31Cl2N3O4/c1-3-19(8-9-22(29)18(2)28)20-10-13-32(14-11-20)12-5-15-34-23-6-4-7-24-21(23)16-25(35-24)27-31-30-26(17-33)36-27/h3-4,6-7,9,16,20,33H,2,5,8,10-15,17H2,1H3/b19-3+,22-9- |
| InChIKey | LKMGVUCMPJUIAB-XJQOINPGSA-N |
| XLogP | 6.67 |
| TPSA | 84.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|