C13H21F3O — CID 174114541
1-[(3S,4S)-4-ethyl-2,3-dimethyl-2-[(2S)-1,1,1-trifluoropropan-2-yl]cyclobutyl]ethenol (PubChem CID 174114541) has the molecular formula C13H21F3O and a molecular weight of 250.30 g/mol. Its IUPAC name is 1-[(3S,4S)-4-ethyl-2,3-dimethyl-2-[(2S)-1,1,1-trifluoropropan-2-yl]cyclobutyl]ethenol.
| Compound Name | 1-[(3S,4S)-4-ethyl-2,3-dimethyl-2-[(2S)-1,1,1-trifluoropropan-2-yl]cyclobutyl]ethenol |
|---|---|
| PubChem CID | 174114541 |
| Molecular Formula | C13H21F3O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1-[(3S,4S)-4-ethyl-2,3-dimethyl-2-[(2S)-1,1,1-trifluoropropan-2-yl]cyclobutyl]ethenol |
| SMILES | C=C(O)C1[C@@H](CC)[C@H](C)C1(C)[C@H](C)C(F)(F)F |
| InChI | InChI=1S/C13H21F3O/c1-6-10-7(2)12(5,11(10)8(3)17)9(4)13(14,15)16/h7,9-11,17H,3,6H2,1-2,4-5H3/t7-,9-,10-,11?,12?/m0/s1 |
| InChIKey | BIYNINOWFVMNJY-ULQKWDOUSA-N |
| XLogP | 4.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|