About CID 174115765
CID 174115765 (PubChem CID 174115765) has the molecular formula C21H27BN5O2
and a molecular weight of 392.29 g/mol.
Molecular Properties
| Compound Name | CID 174115765 |
| PubChem CID | 174115765 |
| Molecular Formula | C21H27BN5O2 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | — |
| SMILES | CCCN(CCC)C(=O)C1=Cc2nn(Cc3ccc([B]O)cc3)cc2N=C(N)C1 |
| InChI | InChI=1S/C21H27BN5O2/c1-3-9-26(10-4-2)21(28)16-11-18-19(24-20(23)12-16)14-27(25-18)13-15-5-7-17(22-29)8-6-15/h5-8,11,14,29H,3-4,9-10,12-13H2,1-2H3,(H2,23,24) |
| InChIKey | KZQXPVBUDINOEO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174115765 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174115765?
The IUPAC name of CID 174115765 (CID 174115765) is not available.
What is the SMILES notation for CID 174115765?
The canonical SMILES for CID 174115765 is CCCN(CCC)C(=O)C1=Cc2nn(Cc3ccc([B]O)cc3)cc2N=C(N)C1.
What is the InChIKey of CID 174115765?
The InChIKey is KZQXPVBUDINOEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27BN5O2/c1-3-9-26(10-4-2)21(28)16-11-18-19(24-20(23)12-16)14-27(25-18)13-15-5-7-17(22-29)8-6-15/h5-8,11,14,29H,3-4,9-10,12-13H2,1-2H3,(H2,23,24).
What are the key properties of CID 174115765?
CID 174115765 has a molecular weight of 392.29 g/mol, XLogP of 1.59, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174115765 is sourced from PubChem (CID 174115765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).