C23H24N4O — CID 174115878
(2E,3Z)-2-ethylidene-N'-hydroxy-5-(8,9,10,11-tetrahydro-6H-pyrrolo[3,2-a]phenanthridin-7-yl)hexa-3,5-dienimidamide (PubChem CID 174115878) has the molecular formula C23H24N4O and a molecular weight of 372.47 g/mol. Its IUPAC name is (2E,3Z)-2-ethylidene-N'-hydroxy-5-(8,9,10,11-tetrahydro-6H-pyrrolo[3,2-a]phenanthridin-7-yl)hexa-3,5-dienimidamide.
| Compound Name | (2E,3Z)-2-ethylidene-N'-hydroxy-5-(8,9,10,11-tetrahydro-6H-pyrrolo[3,2-a]phenanthridin-7-yl)hexa-3,5-dienimidamide |
|---|---|
| PubChem CID | 174115878 |
| Molecular Formula | C23H24N4O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | (2E,3Z)-2-ethylidene-N'-hydroxy-5-(8,9,10,11-tetrahydro-6H-pyrrolo[3,2-a]phenanthridin-7-yl)hexa-3,5-dienimidamide |
| SMILES | C=C(/C=C\C(=C/C)C(N)=NO)c1[nH]c2ccc3nccc3c2c2c1CCCC2 |
| InChI | InChI=1S/C23H24N4O/c1-3-15(23(24)27-28)9-8-14(2)22-17-7-5-4-6-16(17)21-18-12-13-25-19(18)10-11-20(21)26-22/h3,8-13,26,28H,2,4-7H2,1H3,(H2,24,27)/b9-8-,15-3+ |
| InChIKey | QZYIUCDDXHXIPH-IROFQVOHSA-N |
| XLogP | 4.86 |
| TPSA | 87.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|