C30H33BN8O2P2S — CID 174116244
CID 174116244 (PubChem CID 174116244) has the molecular formula C30H33BN8O2P2S and a molecular weight of 642.48 g/mol.
| Compound Name | CID 174116244 |
|---|---|
| PubChem CID | 174116244 |
| Molecular Formula | C30H33BN8O2P2S |
| Molecular Weight | 642.48 g/mol |
| Exact Mass | 642.20 |
| IUPAC Name | — |
| SMILES | [B]c1c(C)ccc(C(P)P)c1-c1cnc(CSC2CC2)c(C(=O)Nc2cnn(Cc3cnc(N4CC[C@@H](C)C4=O)nc3)c2)n1 |
| InChI | InChI=1S/C30H33BN8O2P2S/c1-16-3-6-21(29(42)43)24(25(16)31)22-12-32-23(15-44-20-4-5-20)26(37-22)27(40)36-19-11-35-38(14-19)13-18-9-33-30(34-10-18)39-8-7-17(2)28(39)41/h3,6,9-12,14,17,20,29H,4-5,7-8,13,15,42-43H2,1-2H3,(H,36,40)/t17-/m1/s1 |
| InChIKey | PPTGCVDGQFZOGR-QGZVFWFLSA-N |
| XLogP | 4.05 |
| TPSA | 118.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|