C45H20B7N3O — CID 174116567
CID 174116567 (PubChem CID 174116567) has the molecular formula C45H20B7N3O and a molecular weight of 694.36 g/mol.
| Compound Name | CID 174116567 |
|---|---|
| PubChem CID | 174116567 |
| Molecular Formula | C45H20B7N3O |
| Molecular Weight | 694.36 g/mol |
| Exact Mass | 695.23 |
| IUPAC Name | — |
| SMILES | [B]c1cc2c(cc1[B])c1c([B])c([B])cc([B])c1c1c([B])c(-c3cccc4c3oc3cccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c34)c([B])cc21 |
| InChI | InChI=1S/C45H20B7N3O/c46-29-17-26-27(18-30(29)47)37-39(32(49)20-33(50)40(37)51)38-28(26)19-31(48)36(41(38)52)24-14-7-13-23-35-25(15-8-16-34(35)56-42(23)24)45-54-43(21-9-3-1-4-10-21)53-44(55-45)22-11-5-2-6-12-22/h1-20H |
| InChIKey | FINVVYZNTWLLIO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|