About N-[(1E,3Z)-1-(triazol-1-yl)penta-1,3-dienyl]butan-2-imine
N-[(1E,3Z)-1-(triazol-1-yl)penta-1,3-dienyl]butan-2-imine (PubChem CID 174116654) has the molecular formula C11H16N4
and a molecular weight of 204.28 g/mol. Its IUPAC name is N-[(1E,3Z)-1-(triazol-1-yl)penta-1,3-dienyl]butan-2-imine.
Molecular Properties
| Compound Name | N-[(1E,3Z)-1-(triazol-1-yl)penta-1,3-dienyl]butan-2-imine |
| PubChem CID | 174116654 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | N-[(1E,3Z)-1-(triazol-1-yl)penta-1,3-dienyl]butan-2-imine |
| SMILES | C/C=C\C=C(/N=C(C)CC)n1ccnn1 |
| InChI | InChI=1S/C11H16N4/c1-4-6-7-11(13-10(3)5-2)15-9-8-12-14-15/h4,6-9H,5H2,1-3H3/b6-4-,11-7+,13-10? |
| InChIKey | LDBGXUJOLQJWNQ-ZUDHEZELSA-N |
| XLogP | 2.52 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1E,3Z)-1-(triazol-1-yl)penta-1,3-dienyl]butan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1E,3Z)-1-(triazol-1-yl)penta-1,3-dienyl]butan-2-imine?
The IUPAC name of N-[(1E,3Z)-1-(triazol-1-yl)penta-1,3-dienyl]butan-2-imine (CID 174116654) is N-[(1E,3Z)-1-(triazol-1-yl)penta-1,3-dienyl]butan-2-imine.
What is the SMILES notation for N-[(1E,3Z)-1-(triazol-1-yl)penta-1,3-dienyl]butan-2-imine?
The canonical SMILES for N-[(1E,3Z)-1-(triazol-1-yl)penta-1,3-dienyl]butan-2-imine is C/C=C\C=C(/N=C(C)CC)n1ccnn1.
What is the InChIKey of N-[(1E,3Z)-1-(triazol-1-yl)penta-1,3-dienyl]butan-2-imine?
The InChIKey is LDBGXUJOLQJWNQ-ZUDHEZELSA-N. The full InChI is InChI=1S/C11H16N4/c1-4-6-7-11(13-10(3)5-2)15-9-8-12-14-15/h4,6-9H,5H2,1-3H3/b6-4-,11-7+,13-10?.
What are the key properties of N-[(1E,3Z)-1-(triazol-1-yl)penta-1,3-dienyl]butan-2-imine?
N-[(1E,3Z)-1-(triazol-1-yl)penta-1,3-dienyl]butan-2-imine has a molecular weight of 204.28 g/mol, XLogP of 2.52, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1E,3Z)-1-(triazol-1-yl)penta-1,3-dienyl]butan-2-imine is sourced from PubChem (CID 174116654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).