C22H40NO5Si+ — CID 174116905
[(1R)-1-[4-(2-ethoxy-2-oxoethyl)cyclohexa-1,3-dien-1-yl]ethyl]-(2-methoxypropan-2-yl)-[(2-methylpropan-2-yl)oxycarbonyl]-(silylmethyl)azanium (PubChem CID 174116905) has the molecular formula C22H40NO5Si+ and a molecular weight of 426.65 g/mol. Its IUPAC name is [(1R)-1-[4-(2-ethoxy-2-oxoethyl)cyclohexa-1,3-dien-1-yl]ethyl]-(2-methoxypropan-2-yl)-[(2-methylpropan-2-yl)oxycarbonyl]-(silylmethyl)azanium.
| Compound Name | [(1R)-1-[4-(2-ethoxy-2-oxoethyl)cyclohexa-1,3-dien-1-yl]ethyl]-(2-methoxypropan-2-yl)-[(2-methylpropan-2-yl)oxycarbonyl]-(silylmethyl)azanium |
|---|---|
| PubChem CID | 174116905 |
| Molecular Formula | C22H40NO5Si+ |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | [(1R)-1-[4-(2-ethoxy-2-oxoethyl)cyclohexa-1,3-dien-1-yl]ethyl]-(2-methoxypropan-2-yl)-[(2-methylpropan-2-yl)oxycarbonyl]-(silylmethyl)azanium |
| SMILES | CCOC(=O)CC1=CC=C([C@@H](C)[N+](C[SiH3])(C(=O)OC(C)(C)C)C(C)(C)OC)CC1 |
| InChI | InChI=1S/C22H40NO5Si/c1-9-27-19(24)14-17-10-12-18(13-11-17)16(2)23(15-29,22(6,7)26-8)20(25)28-21(3,4)5/h10,12,16H,9,11,13-15H2,1-8,29H3/q+1/t16-,23?/m1/s1 |
| InChIKey | NUDFUGPLGVVHFU-ADRQNKRLSA-N |
| XLogP | 3.43 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|