About (3Z)-3,4,6-tri(propan-2-yl)-1H-azocin-2-one
(3Z)-3,4,6-tri(propan-2-yl)-1H-azocin-2-one (PubChem CID 174117694) has the molecular formula C16H25NO
and a molecular weight of 247.38 g/mol. Its IUPAC name is (3Z)-3,4,6-tri(propan-2-yl)-1H-azocin-2-one.
Molecular Properties
| Compound Name | (3Z)-3,4,6-tri(propan-2-yl)-1H-azocin-2-one |
| PubChem CID | 174117694 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (3Z)-3,4,6-tri(propan-2-yl)-1H-azocin-2-one |
| SMILES | CC(C)C1=C/C(C(C)C)=C(/C(C)C)C(=O)NC=C1 |
| InChI | InChI=1S/C16H25NO/c1-10(2)13-7-8-17-16(18)15(12(5)6)14(9-13)11(3)4/h7-12H,1-6H3,(H,17,18) |
| InChIKey | BJIWFOSDELQBLY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3Z)-3,4,6-tri(propan-2-yl)-1H-azocin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3,4,6-tri(propan-2-yl)-1H-azocin-2-one?
The IUPAC name of (3Z)-3,4,6-tri(propan-2-yl)-1H-azocin-2-one (CID 174117694) is (3Z)-3,4,6-tri(propan-2-yl)-1H-azocin-2-one.
What is the SMILES notation for (3Z)-3,4,6-tri(propan-2-yl)-1H-azocin-2-one?
The canonical SMILES for (3Z)-3,4,6-tri(propan-2-yl)-1H-azocin-2-one is CC(C)C1=C/C(C(C)C)=C(/C(C)C)C(=O)NC=C1.
What is the InChIKey of (3Z)-3,4,6-tri(propan-2-yl)-1H-azocin-2-one?
The InChIKey is BJIWFOSDELQBLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO/c1-10(2)13-7-8-17-16(18)15(12(5)6)14(9-13)11(3)4/h7-12H,1-6H3,(H,17,18).
What are the key properties of (3Z)-3,4,6-tri(propan-2-yl)-1H-azocin-2-one?
(3Z)-3,4,6-tri(propan-2-yl)-1H-azocin-2-one has a molecular weight of 247.38 g/mol, XLogP of 3.82, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3,4,6-tri(propan-2-yl)-1H-azocin-2-one is sourced from PubChem (CID 174117694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).