C34H28N2+2 — CID 174117846
(3Z)-3-[[2-(1,4-dimethyl-5-phenylpyridin-1-ium-2-yl)phenyl]methylidene]-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(15),5,7,9,11,13-hexaene (PubChem CID 174117846) has the molecular formula C34H28N2+2 and a molecular weight of 464.61 g/mol. Its IUPAC name is (3Z)-3-[[2-(1,4-dimethyl-5-phenylpyridin-1-ium-2-yl)phenyl]methylidene]-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(15),5,7,9,11,13-hexaene.
| Compound Name | (3Z)-3-[[2-(1,4-dimethyl-5-phenylpyridin-1-ium-2-yl)phenyl]methylidene]-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(15),5,7,9,11,13-hexaene |
|---|---|
| PubChem CID | 174117846 |
| Molecular Formula | C34H28N2+2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | (3Z)-3-[[2-(1,4-dimethyl-5-phenylpyridin-1-ium-2-yl)phenyl]methylidene]-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(15),5,7,9,11,13-hexaene |
| SMILES | Cc1cc(-c2ccccc2/C=C2/C3c4ccccc4-c4cccc[n+]4C23)[n+](C)cc1-c1ccccc1 |
| InChI | InChI=1S/C34H28N2/c1-23-20-32(35(2)22-30(23)24-12-4-3-5-13-24)26-15-7-6-14-25(26)21-29-33-28-17-9-8-16-27(28)31-18-10-11-19-36(31)34(29)33/h3-22,33-34H,1-2H3/q+2/b29-21- |
| InChIKey | RJKQMWVIWMDHGC-ANYBSYGZSA-N |
| XLogP | 6.84 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|