C28H50O3Si — CID 174118544
[(1S,3S,4R)-4-[(3aS,4R,5S,7aS)-4,7a-dimethyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylcyclohexyl] acetate (PubChem CID 174118544) has the molecular formula C28H50O3Si and a molecular weight of 462.79 g/mol. Its IUPAC name is [(1S,3S,4R)-4-[(3aS,4R,5S,7aS)-4,7a-dimethyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylcyclohexyl] acetate.
| Compound Name | [(1S,3S,4R)-4-[(3aS,4R,5S,7aS)-4,7a-dimethyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylcyclohexyl] acetate |
|---|---|
| PubChem CID | 174118544 |
| Molecular Formula | C28H50O3Si |
| Molecular Weight | 462.79 g/mol |
| Exact Mass | 462.35 |
| IUPAC Name | [(1S,3S,4R)-4-[(3aS,4R,5S,7aS)-4,7a-dimethyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylcyclohexyl] acetate |
| SMILES | C=C1CC[C@H]2[C@H](C)[C@@H]([C@@]3(C)CC[C@H](OC(C)=O)C[C@@H]3CO[Si](C)(C)C(C)(C)C)CC[C@]12C |
| InChI | InChI=1S/C28H50O3Si/c1-19-11-12-24-20(2)25(14-16-27(19,24)7)28(8)15-13-23(31-21(3)29)17-22(28)18-30-32(9,10)26(4,5)6/h20,22-25H,1,11-18H2,2-10H3/t20-,22+,23-,24-,25-,27+,28-/m0/s1 |
| InChIKey | JGCQMTKZTUVRKL-NMEAXYNMSA-N |
| XLogP | 7.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.79 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|