C23H25N3O5S — CID 17412039
5-methyl-1-(4-methylphenyl)-3-[2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl]imidazolidine-2,4-dione (PubChem CID 17412039) has the molecular formula C23H25N3O5S and a molecular weight of 455.54 g/mol. Its IUPAC name is 5-methyl-1-(4-methylphenyl)-3-[2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl]imidazolidine-2,4-dione.
| Compound Name | 5-methyl-1-(4-methylphenyl)-3-[2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 17412039 |
| Molecular Formula | C23H25N3O5S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 5-methyl-1-(4-methylphenyl)-3-[2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(N2C(=O)N(CC(=O)c3ccc(S(=O)(=O)N4CCCC4)cc3)C(=O)C2C)cc1 |
| InChI | InChI=1S/C23H25N3O5S/c1-16-5-9-19(10-6-16)26-17(2)22(28)25(23(26)29)15-21(27)18-7-11-20(12-8-18)32(30,31)24-13-3-4-14-24/h5-12,17H,3-4,13-15H2,1-2H3 |
| InChIKey | PIBKOOQHARQWME-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|