C65H66BN2S — CID 174120893
CID 174120893 (PubChem CID 174120893) has the molecular formula C65H66BN2S and a molecular weight of 918.14 g/mol.
| Compound Name | CID 174120893 |
|---|---|
| PubChem CID | 174120893 |
| Molecular Formula | C65H66BN2S |
| Molecular Weight | 918.14 g/mol |
| Exact Mass | 917.50 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(Nc2cc3c(cc2-c2c4c5c(c6cc7c(cc6n5-c5cc6c(cc5[B]4)C(C)(C)c4ccccc4-6)C(C)(C)CCC7(C)C)c4c2sc2ccccc24)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C65H66BN2S/c1-60(2,3)36-22-24-37(25-23-36)67-50-34-47-45(61(4,5)26-28-63(47,8)9)30-41(50)56-57-58-54(55-39-19-15-17-21-53(39)69-59(55)56)42-31-46-48(64(10,11)29-27-62(46,6)7)35-51(42)68(58)52-32-40-38-18-14-16-20-43(38)65(12,13)44(40)33-49(52)66-57/h14-25,30-35,67H,26-29H2,1-13H3 |
| InChIKey | OJVZIQUXCKUZAA-UHFFFAOYSA-N |
| XLogP | 16.83 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.14 |
| LogP ≤ 5 | 16.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|