C42H58O5 — CID 174121192
(1-ethylcyclohexyl) 8-[4-(1-ethoxyethoxy)phenyl]-2-ethyl-6-(4-hydroxyphenyl)-2-methyl-4-phenylnonanoate (PubChem CID 174121192) has the molecular formula C42H58O5 and a molecular weight of 642.92 g/mol. Its IUPAC name is (1-ethylcyclohexyl) 8-[4-(1-ethoxyethoxy)phenyl]-2-ethyl-6-(4-hydroxyphenyl)-2-methyl-4-phenylnonanoate.
| Compound Name | (1-ethylcyclohexyl) 8-[4-(1-ethoxyethoxy)phenyl]-2-ethyl-6-(4-hydroxyphenyl)-2-methyl-4-phenylnonanoate |
|---|---|
| PubChem CID | 174121192 |
| Molecular Formula | C42H58O5 |
| Molecular Weight | 642.92 g/mol |
| Exact Mass | 642.43 |
| IUPAC Name | (1-ethylcyclohexyl) 8-[4-(1-ethoxyethoxy)phenyl]-2-ethyl-6-(4-hydroxyphenyl)-2-methyl-4-phenylnonanoate |
| SMILES | CCOC(C)Oc1ccc(C(C)CC(CC(CC(C)(CC)C(=O)OC2(CC)CCCCC2)c2ccccc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C42H58O5/c1-7-41(6,40(44)47-42(8-2)26-14-11-15-27-42)30-37(34-16-12-10-13-17-34)29-36(35-18-22-38(43)23-19-35)28-31(4)33-20-24-39(25-21-33)46-32(5)45-9-3/h10,12-13,16-25,31-32,36-37,43H,7-9,11,14-15,26-30H2,1-6H3 |
| InChIKey | XHJDLCVZMVGGMO-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.92 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|