C30H16N6 — CID 174122625
9-(3-cyano-5-pyrido[3,4-b]indol-9-ylphenyl)pyrido[3,4-b]indole-3-carbonitrile (PubChem CID 174122625) has the molecular formula C30H16N6 and a molecular weight of 460.50 g/mol. Its IUPAC name is 9-(3-cyano-5-pyrido[3,4-b]indol-9-ylphenyl)pyrido[3,4-b]indole-3-carbonitrile.
| Compound Name | 9-(3-cyano-5-pyrido[3,4-b]indol-9-ylphenyl)pyrido[3,4-b]indole-3-carbonitrile |
|---|---|
| PubChem CID | 174122625 |
| Molecular Formula | C30H16N6 |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 9-(3-cyano-5-pyrido[3,4-b]indol-9-ylphenyl)pyrido[3,4-b]indole-3-carbonitrile |
| SMILES | N#Cc1cc(-n2c3ccccc3c3ccncc32)cc(-n2c3ccccc3c3cc(C#N)ncc32)c1 |
| InChI | InChI=1S/C30H16N6/c31-15-19-11-21(35-27-7-3-1-5-23(27)25-9-10-33-17-29(25)35)14-22(12-19)36-28-8-4-2-6-24(28)26-13-20(16-32)34-18-30(26)36/h1-14,17-18H |
| InChIKey | DANIKRXBYVZQBG-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 83.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |