About CID 174122668
CID 174122668 (PubChem CID 174122668) has the molecular formula C63H48BN4OS
and a molecular weight of 919.98 g/mol.
Molecular Properties
| Compound Name | CID 174122668 |
| PubChem CID | 174122668 |
| Molecular Formula | C63H48BN4OS |
| Molecular Weight | 919.98 g/mol |
| Exact Mass | 919.36 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(Nc2cc3c(cc2-c2ccc4c5cc6oc7ccccc7c6cc5n5c4c2[B]c2cc4nc(-c6ccccc6)n(-c6ccccc6)c4cc2-5)sc2cc(C(C)(C)C)ccc23)cc1 |
| InChI | InChI=1S/C63H48BN4OS/c1-62(2,3)37-21-24-39(25-22-37)65-50-30-48-42-26-23-38(63(4,5)6)29-57(42)70-58(48)33-45(50)43-27-28-44-46-32-56-47(41-19-13-14-20-55(41)69-56)31-52(46)68-53-35-54-51(34-49(53)64-59(43)60(44)68)66-61(36-15-9-7-10-16-36)67(54)40-17-11-8-12-18-40/h7-35,65H,1-6H3 |
| InChIKey | XAYUSNPVIYKCIA-UHFFFAOYSA-N |
| XLogP | 16.03 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 70 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 919.98 |
| LogP ≤ 5 | 16.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174122668 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174122668?
The IUPAC name of CID 174122668 (CID 174122668) is not available.
What is the SMILES notation for CID 174122668?
The canonical SMILES for CID 174122668 is CC(C)(C)c1ccc(Nc2cc3c(cc2-c2ccc4c5cc6oc7ccccc7c6cc5n5c4c2[B]c2cc4nc(-c6ccccc6)n(-c6ccccc6)c4cc2-5)sc2cc(C(C)(C)C)ccc23)cc1.
What is the InChIKey of CID 174122668?
The InChIKey is XAYUSNPVIYKCIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C63H48BN4OS/c1-62(2,3)37-21-24-39(25-22-37)65-50-30-48-42-26-23-38(63(4,5)6)29-57(42)70-58(48)33-45(50)43-27-28-44-46-32-56-47(41-19-13-14-20-55(41)69-56)31-52(46)68-53-35-54-51(34-49(53)64-59(43)60(44)68)66-61(36-15-9-7-10-16-36)67(54)40-17-11-8-12-18-40/h7-35,65H,1-6H3.
What are the key properties of CID 174122668?
CID 174122668 has a molecular weight of 919.98 g/mol, XLogP of 16.03, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174122668 is sourced from PubChem (CID 174122668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).