About CID 174122878
CID 174122878 (PubChem CID 174122878) has the molecular formula C60H48BN2S3
and a molecular weight of 904.07 g/mol.
Molecular Properties
| Compound Name | CID 174122878 |
| PubChem CID | 174122878 |
| Molecular Formula | C60H48BN2S3 |
| Molecular Weight | 904.07 g/mol |
| Exact Mass | 903.31 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(Nc2cc3c(cc2-c2ccc4c5cc6c(cc5n5c4c2[B]c2cc4c(cc2-5)sc2ccccc24)sc2ccccc26)sc2cc4c(cc23)C(C)(C)CCC4(C)C)cc1 |
| InChI | InChI=1S/C60H48BN2S3/c1-58(2,3)32-16-18-33(19-17-32)62-47-27-43-41-25-44-45(60(6,7)23-22-59(44,4)5)29-53(41)66-52(43)28-38(47)36-20-21-37-39-24-40-34-12-8-10-14-50(34)64-54(40)30-48(39)63-49-31-55-42(26-46(49)61-56(36)57(37)63)35-13-9-11-15-51(35)65-55/h8-21,24-31,62H,22-23H2,1-7H3 |
| InChIKey | DKGQXBQLPAZHCI-UHFFFAOYSA-N |
| XLogP | 16.91 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 66 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 904.07 |
| LogP ≤ 5 | 16.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174122878 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174122878?
The IUPAC name of CID 174122878 (CID 174122878) is not available.
What is the SMILES notation for CID 174122878?
The canonical SMILES for CID 174122878 is CC(C)(C)c1ccc(Nc2cc3c(cc2-c2ccc4c5cc6c(cc5n5c4c2[B]c2cc4c(cc2-5)sc2ccccc24)sc2ccccc26)sc2cc4c(cc23)C(C)(C)CCC4(C)C)cc1.
What is the InChIKey of CID 174122878?
The InChIKey is DKGQXBQLPAZHCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C60H48BN2S3/c1-58(2,3)32-16-18-33(19-17-32)62-47-27-43-41-25-44-45(60(6,7)23-22-59(44,4)5)29-53(41)66-52(43)28-38(47)36-20-21-37-39-24-40-34-12-8-10-14-50(34)64-54(40)30-48(39)63-49-31-55-42(26-46(49)61-56(36)57(37)63)35-13-9-11-15-51(35)65-55/h8-21,24-31,62H,22-23H2,1-7H3.
What are the key properties of CID 174122878?
CID 174122878 has a molecular weight of 904.07 g/mol, XLogP of 16.91, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174122878 is sourced from PubChem (CID 174122878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).