C46H29B2N3O — CID 174132160
CID 174132160 (PubChem CID 174132160) has the molecular formula C46H29B2N3O and a molecular weight of 661.38 g/mol.
| Compound Name | CID 174132160 |
|---|---|
| PubChem CID | 174132160 |
| Molecular Formula | C46H29B2N3O |
| Molecular Weight | 661.38 g/mol |
| Exact Mass | 661.25 |
| IUPAC Name | — |
| SMILES | [B]C1([B])Oc2cccc(-c3cccc(-c4nc(-c5ccc(-c6ccccc6)cc5)nc(-c5cccc(-c6ccccc6)c5)n4)c3)c2-c2ccccc21 |
| InChI | InChI=1S/C46H29B2N3O/c47-46(48)40-22-8-7-20-39(40)42-38(21-11-23-41(42)52-46)35-17-10-19-37(29-35)45-50-43(33-26-24-32(25-27-33)30-12-3-1-4-13-30)49-44(51-45)36-18-9-16-34(28-36)31-14-5-2-6-15-31/h1-29H |
| InChIKey | QVZKGMANGLLQJX-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.38 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|