C24H25ClF2N2O5S — CID 174132848
(2R,4R)-N-[(4-chloro-2,5-difluorophenyl)-(oxetan-3-yl)methyl]-4-methyl-1-(3-methylsulfonylbenzoyl)pyrrolidine-2-carboxamide (PubChem CID 174132848) has the molecular formula C24H25ClF2N2O5S and a molecular weight of 526.99 g/mol. Its IUPAC name is (2R,4R)-N-[(4-chloro-2,5-difluorophenyl)-(oxetan-3-yl)methyl]-4-methyl-1-(3-methylsulfonylbenzoyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,4R)-N-[(4-chloro-2,5-difluorophenyl)-(oxetan-3-yl)methyl]-4-methyl-1-(3-methylsulfonylbenzoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 174132848 |
| Molecular Formula | C24H25ClF2N2O5S |
| Molecular Weight | 526.99 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | (2R,4R)-N-[(4-chloro-2,5-difluorophenyl)-(oxetan-3-yl)methyl]-4-methyl-1-(3-methylsulfonylbenzoyl)pyrrolidine-2-carboxamide |
| SMILES | C[C@@H]1C[C@H](C(=O)NC(c2cc(F)c(Cl)cc2F)C2COC2)N(C(=O)c2cccc(S(C)(=O)=O)c2)C1 |
| InChI | InChI=1S/C24H25ClF2N2O5S/c1-13-6-21(29(10-13)24(31)14-4-3-5-16(7-14)35(2,32)33)23(30)28-22(15-11-34-12-15)17-8-20(27)18(25)9-19(17)26/h3-5,7-9,13,15,21-22H,6,10-12H2,1-2H3,(H,28,30)/t13-,21-,22?/m1/s1 |
| InChIKey | NOVHEHCIDWJJBM-UWSLFUFESA-N |
| XLogP | 3.38 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.99 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|