C38H42BNO3 — CID 174133174
2-tert-butyl-5-(4-tert-butylphenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1]benzofuro[3,2-c]carbazole (PubChem CID 174133174) has the molecular formula C38H42BNO3 and a molecular weight of 571.57 g/mol. Its IUPAC name is 2-tert-butyl-5-(4-tert-butylphenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1]benzofuro[3,2-c]carbazole.
| Compound Name | 2-tert-butyl-5-(4-tert-butylphenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1]benzofuro[3,2-c]carbazole |
|---|---|
| PubChem CID | 174133174 |
| Molecular Formula | C38H42BNO3 |
| Molecular Weight | 571.57 g/mol |
| Exact Mass | 571.33 |
| IUPAC Name | 2-tert-butyl-5-(4-tert-butylphenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1]benzofuro[3,2-c]carbazole |
| SMILES | CC(C)(C)c1ccc(-n2c3ccc(C(C)(C)C)cc3c3c4oc5ccccc5c4c(B4OC(C)(C)C(C)(C)O4)cc32)cc1 |
| InChI | InChI=1S/C38H42BNO3/c1-35(2,3)23-15-18-25(19-16-23)40-29-20-17-24(36(4,5)6)21-27(29)33-30(40)22-28(39-42-37(7,8)38(9,10)43-39)32-26-13-11-12-14-31(26)41-34(32)33/h11-22H,1-10H3 |
| InChIKey | QYQPMDWDNRBSEG-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 36.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.57 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|