C18H21NS — CID 174134424
(1E,3E,8E,10Z,14E)-3,12-dimethyl-5,7-dimethylidene-6-thia-2-azabicyclo[7.7.0]hexadeca-1(16),3,8,10,14-pentaene (PubChem CID 174134424) has the molecular formula C18H21NS and a molecular weight of 283.44 g/mol. Its IUPAC name is (1E,3E,8E,10Z,14E)-3,12-dimethyl-5,7-dimethylidene-6-thia-2-azabicyclo[7.7.0]hexadeca-1(16),3,8,10,14-pentaene.
| Compound Name | (1E,3E,8E,10Z,14E)-3,12-dimethyl-5,7-dimethylidene-6-thia-2-azabicyclo[7.7.0]hexadeca-1(16),3,8,10,14-pentaene |
|---|---|
| PubChem CID | 174134424 |
| Molecular Formula | C18H21NS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (1E,3E,8E,10Z,14E)-3,12-dimethyl-5,7-dimethylidene-6-thia-2-azabicyclo[7.7.0]hexadeca-1(16),3,8,10,14-pentaene |
| SMILES | C=C1/C=C(/C)N/C2=C/C=C/CC(C)/C=C/C2=C/C(=C)S1 |
| InChI | InChI=1S/C18H21NS/c1-13-7-5-6-8-18-17(10-9-13)12-16(4)20-15(3)11-14(2)19-18/h5-6,8-13,19H,3-4,7H2,1-2H3/b6-5+,10-9+,14-11-,17-12-,18-8+ |
| InChIKey | VFUOXZOJRKZRBN-MJASVWFKSA-N |
| XLogP | 5.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |