C16H12N2S — CID 174134452
(3Z)-11-methylidene-12-thia-6,10-diazatricyclo[11.5.0.04,9]octadeca-1(13),3,5,7,9,14,15,17-octaene (PubChem CID 174134452) has the molecular formula C16H12N2S and a molecular weight of 264.35 g/mol. Its IUPAC name is (3Z)-11-methylidene-12-thia-6,10-diazatricyclo[11.5.0.04,9]octadeca-1(13),3,5,7,9,14,15,17-octaene.
| Compound Name | (3Z)-11-methylidene-12-thia-6,10-diazatricyclo[11.5.0.04,9]octadeca-1(13),3,5,7,9,14,15,17-octaene |
|---|---|
| PubChem CID | 174134452 |
| Molecular Formula | C16H12N2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | (3Z)-11-methylidene-12-thia-6,10-diazatricyclo[11.5.0.04,9]octadeca-1(13),3,5,7,9,14,15,17-octaene |
| SMILES | C=C1N=c2ccnc/c2=C/CC2=C(C=C=CC=C2)S1 |
| InChI | InChI=1S/C16H12N2S/c1-12-18-15-9-10-17-11-14(15)8-7-13-5-3-2-4-6-16(13)19-12/h2-3,5-6,8-11H,1,7H2/b14-8-,18-15? |
| InChIKey | TUOOBPKSPWDVEL-BYASSLIOSA-N |
| XLogP | 2.62 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |