C12H19N2+ — CID 174134577
(8R)-1,4,7,8-tetramethyl-3,4,7,8-tetrahydroquinazolin-1-ium (PubChem CID 174134577) has the molecular formula C12H19N2+ and a molecular weight of 191.30 g/mol. Its IUPAC name is (8R)-1,4,7,8-tetramethyl-3,4,7,8-tetrahydroquinazolin-1-ium.
| Compound Name | (8R)-1,4,7,8-tetramethyl-3,4,7,8-tetrahydroquinazolin-1-ium |
|---|---|
| PubChem CID | 174134577 |
| Molecular Formula | C12H19N2+ |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.15 |
| IUPAC Name | (8R)-1,4,7,8-tetramethyl-3,4,7,8-tetrahydroquinazolin-1-ium |
| SMILES | CC1NC=[N+](C)C2=C1C=CC(C)[C@H]2C |
| InChI | InChI=1S/C12H18N2/c1-8-5-6-11-10(3)13-7-14(4)12(11)9(8)2/h5-10H,1-4H3/p+1/t8?,9-,10?/m1/s1 |
| InChIKey | LUPKVYDUTGHEDO-HWOCKDDLSA-O |
| XLogP | 1.74 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|