About CID 174134846
CID 174134846 (PubChem CID 174134846) has the molecular formula C24H16BClF2N8O3
and a molecular weight of 548.71 g/mol.
Molecular Properties
| Compound Name | CID 174134846 |
| PubChem CID | 174134846 |
| Molecular Formula | C24H16BClF2N8O3 |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | — |
| SMILES | [B][C@]12CC[C@@H](c3ncc(-c4ccnc(C(=O)O)c4F)[nH]3)N1C(=O)C=C(c1c(-n3cnnn3)ccc(Cl)c1F)C2 |
| InChI | InChI=1S/C24H16BClF2N8O3/c25-24-5-3-16(22-30-9-14(32-22)12-4-6-29-21(19(12)27)23(38)39)36(24)17(37)7-11(8-24)18-15(35-10-31-33-34-35)2-1-13(26)20(18)28/h1-2,4,6-7,9-10,16H,3,5,8H2,(H,30,32)(H,38,39)/t16-,24+/m0/s1 |
| InChIKey | BEWKOYFJGNGGFL-UPCLLVRISA-N |
| XLogP | 3.09 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174134846 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174134846?
The IUPAC name of CID 174134846 (CID 174134846) is not available.
What is the SMILES notation for CID 174134846?
The canonical SMILES for CID 174134846 is [B][C@]12CC[C@@H](c3ncc(-c4ccnc(C(=O)O)c4F)[nH]3)N1C(=O)C=C(c1c(-n3cnnn3)ccc(Cl)c1F)C2.
What is the InChIKey of CID 174134846?
The InChIKey is BEWKOYFJGNGGFL-UPCLLVRISA-N. The full InChI is InChI=1S/C24H16BClF2N8O3/c25-24-5-3-16(22-30-9-14(32-22)12-4-6-29-21(19(12)27)23(38)39)36(24)17(37)7-11(8-24)18-15(35-10-31-33-34-35)2-1-13(26)20(18)28/h1-2,4,6-7,9-10,16H,3,5,8H2,(H,30,32)(H,38,39)/t16-,24+/m0/s1.
What are the key properties of CID 174134846?
CID 174134846 has a molecular weight of 548.71 g/mol, XLogP of 3.09, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174134846 is sourced from PubChem (CID 174134846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).