About CID 174134904
CID 174134904 (PubChem CID 174134904) has the molecular formula C25H23B7F3N5O2
and a molecular weight of 558.17 g/mol.
Molecular Properties
| Compound Name | CID 174134904 |
| PubChem CID | 174134904 |
| Molecular Formula | C25H23B7F3N5O2 |
| Molecular Weight | 558.17 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(C([B])([B])N2CC3(CC(OC(=O)N4[C@H](C)CN(c5cnc(C(F)(F)F)cn5)C[C@@H]4C)C3)C2)c([B])c1[B] |
| InChI | InChI=1S/C25H23B7F3N5O2/c1-11-7-38(15-6-36-14(5-37-15)25(33,34)35)8-12(2)40(11)22(41)42-13-3-23(4-13)9-39(10-23)24(31,32)16-17(26)19(28)21(30)20(29)18(16)27/h5-6,11-13H,3-4,7-10H2,1-2H3/t11-,12+ |
| InChIKey | RLJDZGCRJYLCIG-TXEJJXNPSA-N |
| XLogP | -2.89 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 558.17 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174134904 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174134904?
The IUPAC name of CID 174134904 (CID 174134904) is not available.
What is the SMILES notation for CID 174134904?
The canonical SMILES for CID 174134904 is [B]c1c([B])c([B])c(C([B])([B])N2CC3(CC(OC(=O)N4[C@H](C)CN(c5cnc(C(F)(F)F)cn5)C[C@@H]4C)C3)C2)c([B])c1[B].
What is the InChIKey of CID 174134904?
The InChIKey is RLJDZGCRJYLCIG-TXEJJXNPSA-N. The full InChI is InChI=1S/C25H23B7F3N5O2/c1-11-7-38(15-6-36-14(5-37-15)25(33,34)35)8-12(2)40(11)22(41)42-13-3-23(4-13)9-39(10-23)24(31,32)16-17(26)19(28)21(30)20(29)18(16)27/h5-6,11-13H,3-4,7-10H2,1-2H3/t11-,12+.
What are the key properties of CID 174134904?
CID 174134904 has a molecular weight of 558.17 g/mol, XLogP of -2.89, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174134904 is sourced from PubChem (CID 174134904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).