C11H21N3O7S — CID 174135139
(5R,7S,8R)-5-(butylsulfamoylamino)-6,7,8-trihydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 174135139) has the molecular formula C11H21N3O7S and a molecular weight of 339.37 g/mol. Its IUPAC name is (5R,7S,8R)-5-(butylsulfamoylamino)-6,7,8-trihydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
| Compound Name | (5R,7S,8R)-5-(butylsulfamoylamino)-6,7,8-trihydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
|---|---|
| PubChem CID | 174135139 |
| Molecular Formula | C11H21N3O7S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (5R,7S,8R)-5-(butylsulfamoylamino)-6,7,8-trihydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
| SMILES | CCCCNS(=O)(=O)N[C@@H]1C(O)[C@@H](O)[C@H](O)C2COC(=O)N21 |
| InChI | InChI=1S/C11H21N3O7S/c1-2-3-4-12-22(19,20)13-10-9(17)8(16)7(15)6-5-21-11(18)14(6)10/h6-10,12-13,15-17H,2-5H2,1H3/t6?,7-,8+,9?,10+/m1/s1 |
| InChIKey | GJNLHZOBUBCTLF-CVXLIIGASA-N |
| XLogP | -2.55 |
| TPSA | 148.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|