C28H50O7Si — CID 174135181
2-[(1S,2'S,3R,4'S,5S,7R,9S,11R,13S)-5-[(2S)-butan-2-yl]-4',13-dimethyl-3'-triethylsilyloxyspiro[2,6,10-trioxatricyclo[7.4.0.03,7]tridecane-11,6'-oxane]-2'-yl]acetic acid (PubChem CID 174135181) has the molecular formula C28H50O7Si and a molecular weight of 526.79 g/mol. Its IUPAC name is 2-[(1S,2'S,3R,4'S,5S,7R,9S,11R,13S)-5-[(2S)-butan-2-yl]-4',13-dimethyl-3'-triethylsilyloxyspiro[2,6,10-trioxatricyclo[7.4.0.03,7]tridecane-11,6'-oxane]-2'-yl]acetic acid.
| Compound Name | 2-[(1S,2'S,3R,4'S,5S,7R,9S,11R,13S)-5-[(2S)-butan-2-yl]-4',13-dimethyl-3'-triethylsilyloxyspiro[2,6,10-trioxatricyclo[7.4.0.03,7]tridecane-11,6'-oxane]-2'-yl]acetic acid |
|---|---|
| PubChem CID | 174135181 |
| Molecular Formula | C28H50O7Si |
| Molecular Weight | 526.79 g/mol |
| Exact Mass | 526.33 |
| IUPAC Name | 2-[(1S,2'S,3R,4'S,5S,7R,9S,11R,13S)-5-[(2S)-butan-2-yl]-4',13-dimethyl-3'-triethylsilyloxyspiro[2,6,10-trioxatricyclo[7.4.0.03,7]tridecane-11,6'-oxane]-2'-yl]acetic acid |
| SMILES | CC[C@H](C)[C@@H]1C[C@H]2O[C@@H]3[C@H](C[C@H]2O1)O[C@]1(C[C@H](C)C(O[Si](CC)(CC)CC)[C@H](CC(=O)O)O1)C[C@@H]3C |
| InChI | InChI=1S/C28H50O7Si/c1-8-17(5)20-12-22-21(31-20)13-23-26(32-22)18(6)15-28(33-23)16-19(7)27(24(34-28)14-25(29)30)35-36(9-2,10-3)11-4/h17-24,26-27H,8-16H2,1-7H3,(H,29,30)/t17-,18-,19-,20-,21+,22+,23-,24-,26-,27?,28+/m0/s1 |
| InChIKey | ZQIRAUWFMJKVBX-VFZKOTABSA-N |
| XLogP | 5.76 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.79 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|