C25H52O6Si2 — CID 174135254
methyl 4-[(2R,4S,5S)-4,5-dimethyl-3-triethylsilyloxy-6-(triethylsilyloxymethyl)oxan-2-yl]oxybutanoate (PubChem CID 174135254) has the molecular formula C25H52O6Si2 and a molecular weight of 504.86 g/mol. Its IUPAC name is methyl 4-[(2R,4S,5S)-4,5-dimethyl-3-triethylsilyloxy-6-(triethylsilyloxymethyl)oxan-2-yl]oxybutanoate.
| Compound Name | methyl 4-[(2R,4S,5S)-4,5-dimethyl-3-triethylsilyloxy-6-(triethylsilyloxymethyl)oxan-2-yl]oxybutanoate |
|---|---|
| PubChem CID | 174135254 |
| Molecular Formula | C25H52O6Si2 |
| Molecular Weight | 504.86 g/mol |
| Exact Mass | 504.33 |
| IUPAC Name | methyl 4-[(2R,4S,5S)-4,5-dimethyl-3-triethylsilyloxy-6-(triethylsilyloxymethyl)oxan-2-yl]oxybutanoate |
| SMILES | CC[Si](CC)(CC)OCC1O[C@@H](OCCCC(=O)OC)C(O[Si](CC)(CC)CC)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C25H52O6Si2/c1-10-32(11-2,12-3)29-19-22-20(7)21(8)24(31-33(13-4,14-5)15-6)25(30-22)28-18-16-17-23(26)27-9/h20-22,24-25H,10-19H2,1-9H3/t20-,21-,22?,24?,25+/m0/s1 |
| InChIKey | OVNVCNQJDKMQIJ-YJNYXGCFSA-N |
| XLogP | 6.37 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.86 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|