C88H142N10O36PS2- — CID 174135359
CID 174135359 (PubChem CID 174135359) has the molecular formula C88H142N10O36PS2- and a molecular weight of 2011.25 g/mol.
| Compound Name | CID 174135359 |
|---|---|
| PubChem CID | 174135359 |
| Molecular Formula | C88H142N10O36PS2- |
| Molecular Weight | 2011.25 g/mol |
| Exact Mass | 2009.88 |
| IUPAC Name | — |
| SMILES | [H]/P=[S-](=S)/NC(=O)CCC(=O)OC(CC)C(=O)N(CCN(CCNC(=O)CCCCO[C@@H]1OC(COC(C)=O)[C@H](OC(C)=O)[C@H](C)C1NC(C)=O)C(=O)CCCCO[C@@H]1OC(COC(C)=O)[C@H](OC(C)=O)[C@H](C)C1NC(C)=O)CCN(CCNC(=O)CCCCO[C@@H]1OC(COC(C)=O)[C@H](OC(C)=O)[C@H](C)C1NC(C)=O)C(=O)CCCCO[C@@H]1OC(COC(C)=O)[C@H](OC(C)=O)[C@H](C)C1NC(C)=O |
| InChI | InChI=1S/C88H142N10O36PS2/c1-18-65(130-75(116)32-31-72(113)95-137(135)136)84(117)98(39-37-96(73(114)29-21-25-43-120-87-78(93-55(8)101)51(4)82(128-63(16)109)68(133-87)47-124-59(12)105)35-33-89-70(111)27-19-23-41-118-85-76(91-53(6)99)49(2)80(126-61(14)107)66(131-85)45-122-57(10)103)40-38-97(74(115)30-22-26-44-121-88-79(94-56(9)102)52(5)83(129-64(17)110)69(134-88)48-125-60(13)106)36-34-90-71(112)28-20-24-42-119-86-77(92-54(7)100)50(3)81(127-62(15)108)67(132-86)46-123-58(11)104/h49-52,65-69,76-83,85-88,135H,18-48H2,1-17H3,(H,89,111)(H,90,112)(H,91,99)(H,92,100)(H,93,101)(H,94,102)(H,95,113,136)/q-1/t49-,50-,51-,52-,65?,66?,67?,68?,69?,76?,77?,78?,79?,80-,81-,82-,83-,85-,86-,87-,88-/m1/s1 |
| InChIKey | XOFMJFQGBOILPT-VSUGSJBBSA-N |
| XLogP | 1.17 |
| TPSA | 575.17 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 38 |
| Rotatable Bonds | 59 |
| Heavy Atoms | 137 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 2011.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 38 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|