C10H16F4N2O4S — CID 174135361
2-[[1-(2,2-difluoropropyl)pyrrolidine-2-carbonyl]amino]-1,1-difluoroethanesulfonic acid (PubChem CID 174135361) has the molecular formula C10H16F4N2O4S and a molecular weight of 336.31 g/mol. Its IUPAC name is 2-[[1-(2,2-difluoropropyl)pyrrolidine-2-carbonyl]amino]-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-[[1-(2,2-difluoropropyl)pyrrolidine-2-carbonyl]amino]-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 174135361 |
| Molecular Formula | C10H16F4N2O4S |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2-[[1-(2,2-difluoropropyl)pyrrolidine-2-carbonyl]amino]-1,1-difluoroethanesulfonic acid |
| SMILES | CC(F)(F)CN1CCCC1C(=O)NCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C10H16F4N2O4S/c1-9(11,12)6-16-4-2-3-7(16)8(17)15-5-10(13,14)21(18,19)20/h7H,2-6H2,1H3,(H,15,17)(H,18,19,20) |
| InChIKey | BQHKEHSYGKITKX-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|